C16H23F3O2 — CID 103210128
1-[2,4-di(propan-2-yl)phenyl]-2-(2,2,2-trifluoroethoxy)ethanol (PubChem CID 103210128) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]-2-(2,2,2-trifluoroethoxy)ethanol.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]-2-(2,2,2-trifluoroethoxy)ethanol |
|---|---|
| PubChem CID | 103210128 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]-2-(2,2,2-trifluoroethoxy)ethanol |
| SMILES | CC(C)c1ccc(C(O)COCC(F)(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C16H23F3O2/c1-10(2)12-5-6-13(14(7-12)11(3)4)15(20)8-21-9-16(17,18)19/h5-7,10-11,15,20H,8-9H2,1-4H3 |
| InChIKey | HWKYIRZLNJFAAL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |