C20H26O2 — CID 14096565
[2,4-di(propan-2-yl)phenyl]-[4-(hydroxymethyl)phenyl]methanol (PubChem CID 14096565) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is [2,4-di(propan-2-yl)phenyl]-[4-(hydroxymethyl)phenyl]methanol.
| Compound Name | [2,4-di(propan-2-yl)phenyl]-[4-(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 14096565 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [2,4-di(propan-2-yl)phenyl]-[4-(hydroxymethyl)phenyl]methanol |
| SMILES | CC(C)c1ccc(C(O)c2ccc(CO)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C20H26O2/c1-13(2)17-9-10-18(19(11-17)14(3)4)20(22)16-7-5-15(12-21)6-8-16/h5-11,13-14,20-22H,12H2,1-4H3 |
| InChIKey | NPTFFXJHXGIAMU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |