C19H23ClO — CID 63427004
(2-chlorophenyl)-[2,4-di(propan-2-yl)phenyl]methanol (PubChem CID 63427004) has the molecular formula C19H23ClO and a molecular weight of 302.84 g/mol. Its IUPAC name is (2-chlorophenyl)-[2,4-di(propan-2-yl)phenyl]methanol.
| Compound Name | (2-chlorophenyl)-[2,4-di(propan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 63427004 |
| Molecular Formula | C19H23ClO |
| Molecular Weight | 302.84 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2-chlorophenyl)-[2,4-di(propan-2-yl)phenyl]methanol |
| SMILES | CC(C)c1ccc(C(O)c2ccccc2Cl)c(C(C)C)c1 |
| InChI | InChI=1S/C19H23ClO/c1-12(2)14-9-10-15(17(11-14)13(3)4)19(21)16-7-5-6-8-18(16)20/h5-13,19,21H,1-4H3 |
| InChIKey | JROJTJONULHNFF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.84 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |