C14H21ClO — CID 25324257
(1R)-2-chloro-1-[2,4-di(propan-2-yl)phenyl]ethanol (PubChem CID 25324257) has the molecular formula C14H21ClO and a molecular weight of 240.77 g/mol. Its IUPAC name is (1R)-2-chloro-1-[2,4-di(propan-2-yl)phenyl]ethanol.
| Compound Name | (1R)-2-chloro-1-[2,4-di(propan-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 25324257 |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.77 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (1R)-2-chloro-1-[2,4-di(propan-2-yl)phenyl]ethanol |
| SMILES | CC(C)c1ccc([C@@H](O)CCl)c(C(C)C)c1 |
| InChI | InChI=1S/C14H21ClO/c1-9(2)11-5-6-12(14(16)8-15)13(7-11)10(3)4/h5-7,9-10,14,16H,8H2,1-4H3/t14-/m0/s1 |
| InChIKey | XRKKVEHJRHTTGS-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|