C12H18O — CID 18048
2,4-di(propan-2-yl)phenol (PubChem CID 18048) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)phenol.
| Compound Name | 2,4-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 18048 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2,4-di(propan-2-yl)phenol |
| SMILES | CC(C)c1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C12H18O/c1-8(2)10-5-6-12(13)11(7-10)9(3)4/h5-9,13H,1-4H3 |
| InChIKey | KEUMBYCOWGLRBQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |