C11H18O2 — CID 142526046
ethane;2-propan-2-ylbenzene-1,4-diol (PubChem CID 142526046) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is ethane;2-propan-2-ylbenzene-1,4-diol.
| Compound Name | ethane;2-propan-2-ylbenzene-1,4-diol |
|---|---|
| PubChem CID | 142526046 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethane;2-propan-2-ylbenzene-1,4-diol |
| SMILES | CC.CC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H12O2.C2H6/c1-6(2)8-5-7(10)3-4-9(8)11;1-2/h3-6,10-11H,1-2H3;1-2H3 |
| InChIKey | ZORNSBVBNYNOLE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|