C9H13NO2 — CID 3028773
2-(1-aminopropan-2-yl)benzene-1,4-diol (PubChem CID 3028773) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)benzene-1,4-diol.
| Compound Name | 2-(1-aminopropan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 3028773 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-(1-aminopropan-2-yl)benzene-1,4-diol |
| SMILES | CC(CN)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H13NO2/c1-6(5-10)8-4-7(11)2-3-9(8)12/h2-4,6,11-12H,5,10H2,1H3 |
| InChIKey | AXOBVZKJOOCZJL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|