C10H15NO2 — CID 117278779
4-(1-aminopropan-2-yl)-2-methylbenzene-1,3-diol (PubChem CID 117278779) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-2-methylbenzene-1,3-diol.
| Compound Name | 4-(1-aminopropan-2-yl)-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 117278779 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)ccc(C(C)CN)c1O |
| InChI | InChI=1S/C10H15NO2/c1-6(5-11)8-3-4-9(12)7(2)10(8)13/h3-4,6,12-13H,5,11H2,1-2H3 |
| InChIKey | BRLBFYXGAQLIHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |