C8H11NO2 — CID 82502588
4-(aminomethyl)-2-methylbenzene-1,3-diol (PubChem CID 82502588) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-(aminomethyl)-2-methylbenzene-1,3-diol.
| Compound Name | 4-(aminomethyl)-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 82502588 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-(aminomethyl)-2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)ccc(CN)c1O |
| InChI | InChI=1S/C8H11NO2/c1-5-7(10)3-2-6(4-9)8(5)11/h2-3,10-11H,4,9H2,1H3 |
| InChIKey | WOMBGOVLDUHEJX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|