C8H12O3 — CID 172699169
2,3-dimethylbenzene-1,4-diol;hydrate (PubChem CID 172699169) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2,3-dimethylbenzene-1,4-diol;hydrate.
| Compound Name | 2,3-dimethylbenzene-1,4-diol;hydrate |
|---|---|
| PubChem CID | 172699169 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,3-dimethylbenzene-1,4-diol;hydrate |
| SMILES | Cc1c(O)ccc(O)c1C.O |
| InChI | InChI=1S/C8H10O2.H2O/c1-5-6(2)8(10)4-3-7(5)9;/h3-4,9-10H,1-2H3;1H2 |
| InChIKey | LTJIPZXHBVWEHS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|