C9H10F2O — CID 131214195
4-(difluoromethyl)-2,3-dimethylphenol (PubChem CID 131214195) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,3-dimethylphenol.
| Compound Name | 4-(difluoromethyl)-2,3-dimethylphenol |
|---|---|
| PubChem CID | 131214195 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-(difluoromethyl)-2,3-dimethylphenol |
| SMILES | Cc1c(O)ccc(C(F)F)c1C |
| InChI | InChI=1S/C9H10F2O/c1-5-6(2)8(12)4-3-7(5)9(10)11/h3-4,9,12H,1-2H3 |
| InChIKey | VPVFSGLYZRTONB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |