About 2-(difluoromethyl)phenol
2-(difluoromethyl)phenol (PubChem CID 21386914) has the molecular formula C7H6F2O
and a molecular weight of 144.12 g/mol. Its IUPAC name is 2-(difluoromethyl)phenol.
Molecular Properties
| Compound Name | 2-(difluoromethyl)phenol |
| PubChem CID | 21386914 |
| Molecular Formula | C7H6F2O |
| Molecular Weight | 144.12 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-(difluoromethyl)phenol |
| SMILES | Oc1ccccc1C(F)F |
| InChI | InChI=1S/C7H6F2O/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7,10H |
| InChIKey | XSLLINTVUSKCGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)phenol?
The IUPAC name of 2-(difluoromethyl)phenol (CID 21386914) is 2-(difluoromethyl)phenol.
What is the SMILES notation for 2-(difluoromethyl)phenol?
The canonical SMILES for 2-(difluoromethyl)phenol is Oc1ccccc1C(F)F.
What is the InChIKey of 2-(difluoromethyl)phenol?
The InChIKey is XSLLINTVUSKCGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7,10H.
What are the key properties of 2-(difluoromethyl)phenol?
2-(difluoromethyl)phenol has a molecular weight of 144.12 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)phenol is sourced from PubChem (CID 21386914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).