C9H13NO2 — CID 55292695
2-[(1R,2S)-1-amino-2-hydroxypropyl]phenol (PubChem CID 55292695) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxypropyl]phenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 55292695 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxypropyl]phenol |
| SMILES | C[C@H](O)[C@H](N)c1ccccc1O |
| InChI | InChI=1S/C9H13NO2/c1-6(11)9(10)7-4-2-3-5-8(7)12/h2-6,9,11-12H,10H2,1H3/t6-,9-/m0/s1 |
| InChIKey | JXKFVSLCCUBGIK-RCOVLWMOSA-N |
| XLogP | 0.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|