C12H20ClNO2 — CID 171162441
2-[(1S,2R)-1-amino-2-hydroxy-4-methylpentyl]phenol;hydrochloride (PubChem CID 171162441) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-4-methylpentyl]phenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-4-methylpentyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171162441 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-4-methylpentyl]phenol;hydrochloride |
| SMILES | CC(C)C[C@@H](O)[C@@H](N)c1ccccc1O.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-8(2)7-11(15)12(13)9-5-3-4-6-10(9)14;/h3-6,8,11-12,14-15H,7,13H2,1-2H3;1H/t11-,12+;/m1./s1 |
| InChIKey | RKJAZPIKFOTHNT-LYCTWNKOSA-N |
| XLogP | 2.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|