C9H11ClF3NO2 — CID 171161014
2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]phenol;hydrochloride (PubChem CID 171161014) has the molecular formula C9H11ClF3NO2 and a molecular weight of 257.64 g/mol. Its IUPAC name is 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]phenol;hydrochloride.
| Compound Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171161014 |
| Molecular Formula | C9H11ClF3NO2 |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]phenol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccccc1O)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2.ClH/c10-9(11,12)8(15)7(13)5-3-1-2-4-6(5)14;/h1-4,7-8,14-15H,13H2;1H/t7-,8-;/m1./s1 |
| InChIKey | VCOBSCGYZJRCPD-SCLLHFNJSA-N |
| XLogP | 1.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|