C10H15NO2 — CID 130792014
3-[(1R,2R)-1-amino-2-hydroxypropyl]-2-methylphenol (PubChem CID 130792014) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-[(1R,2R)-1-amino-2-hydroxypropyl]-2-methylphenol.
| Compound Name | 3-[(1R,2R)-1-amino-2-hydroxypropyl]-2-methylphenol |
|---|---|
| PubChem CID | 130792014 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-[(1R,2R)-1-amino-2-hydroxypropyl]-2-methylphenol |
| SMILES | Cc1c(O)cccc1[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C10H15NO2/c1-6-8(10(11)7(2)12)4-3-5-9(6)13/h3-5,7,10,12-13H,11H2,1-2H3/t7-,10+/m1/s1 |
| InChIKey | GJVLAVGYPRDBNQ-XCBNKYQSSA-N |
| XLogP | 1.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |