C10H16ClNO — CID 171160087
(1R,2S)-1-amino-1-(2-methylphenyl)propan-2-ol;hydrochloride (PubChem CID 171160087) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-methylphenyl)propan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(2-methylphenyl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171160087 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-methylphenyl)propan-2-ol;hydrochloride |
| SMILES | Cc1ccccc1[C@@H](N)[C@H](C)O.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-7-5-3-4-6-9(7)10(11)8(2)12;/h3-6,8,10,12H,11H2,1-2H3;1H/t8-,10-;/m0./s1 |
| InChIKey | CXCJSQMLLILJBC-GNAZCLTHSA-N |
| XLogP | 1.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |