C14H17NO — CID 171269449
(1S,2R)-1-amino-1-(4-methylnaphthalen-1-yl)propan-2-ol (PubChem CID 171269449) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(4-methylnaphthalen-1-yl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(4-methylnaphthalen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 171269449 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (1S,2R)-1-amino-1-(4-methylnaphthalen-1-yl)propan-2-ol |
| SMILES | Cc1ccc([C@H](N)[C@@H](C)O)c2ccccc12 |
| InChI | InChI=1S/C14H17NO/c1-9-7-8-13(14(15)10(2)16)12-6-4-3-5-11(9)12/h3-8,10,14,16H,15H2,1-2H3/t10-,14-/m1/s1 |
| InChIKey | AAOSZJBOZQXWSJ-QMTHXVAHSA-N |
| XLogP | 2.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |