C16H21N — CID 171242641
(1S)-2,2-dimethyl-1-(4-methylnaphthalen-1-yl)propan-1-amine (PubChem CID 171242641) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-(4-methylnaphthalen-1-yl)propan-1-amine.
| Compound Name | (1S)-2,2-dimethyl-1-(4-methylnaphthalen-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 171242641 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (1S)-2,2-dimethyl-1-(4-methylnaphthalen-1-yl)propan-1-amine |
| SMILES | Cc1ccc([C@@H](N)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C16H21N/c1-11-9-10-14(15(17)16(2,3)4)13-8-6-5-7-12(11)13/h5-10,15H,17H2,1-4H3/t15-/m1/s1 |
| InChIKey | RESSXDDXSNADMG-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |