C19H22ClN — CID 171250653
(1R)-2,2-dimethyl-1-phenanthren-9-ylpropan-1-amine;hydrochloride (PubChem CID 171250653) has the molecular formula C19H22ClN and a molecular weight of 299.85 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-phenanthren-9-ylpropan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2-dimethyl-1-phenanthren-9-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171250653 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (1R)-2,2-dimethyl-1-phenanthren-9-ylpropan-1-amine;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)c1cc2ccccc2c2ccccc12.Cl |
| InChI | InChI=1S/C19H21N.ClH/c1-19(2,3)18(20)17-12-13-8-4-5-9-14(13)15-10-6-7-11-16(15)17;/h4-12,18H,20H2,1-3H3;1H/t18-;/m0./s1 |
| InChIKey | ILKYLWAYAAZUCK-FERBBOLQSA-N |
| XLogP | 5.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|