C18H20N2 — CID 171212804
(1R)-1-phenanthren-9-ylbutane-1,4-diamine (PubChem CID 171212804) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R)-1-phenanthren-9-ylbutane-1,4-diamine.
| Compound Name | (1R)-1-phenanthren-9-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 171212804 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (1R)-1-phenanthren-9-ylbutane-1,4-diamine |
| SMILES | NCCC[C@@H](N)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C18H20N2/c19-11-5-10-18(20)17-12-13-6-1-2-7-14(13)15-8-3-4-9-16(15)17/h1-4,6-9,12,18H,5,10-11,19-20H2/t18-/m1/s1 |
| InChIKey | FFHVSEUKTCNXBG-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|