C10H15IN2 — CID 171210506
(1R)-1-(2-iodophenyl)butane-1,4-diamine (PubChem CID 171210506) has the molecular formula C10H15IN2 and a molecular weight of 290.15 g/mol. Its IUPAC name is (1R)-1-(2-iodophenyl)butane-1,4-diamine.
| Compound Name | (1R)-1-(2-iodophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171210506 |
| Molecular Formula | C10H15IN2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (1R)-1-(2-iodophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@@H](N)c1ccccc1I |
| InChI | InChI=1S/C10H15IN2/c11-9-5-2-1-4-8(9)10(13)6-3-7-12/h1-2,4-5,10H,3,6-7,12-13H2/t10-/m1/s1 |
| InChIKey | XKCBKVKYPWEBGJ-SNVBAGLBSA-N |
| XLogP | 2.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|