C11H19ClN2O — CID 171219977
(1S)-1-(2-methoxyphenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171219977) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is (1S)-1-(2-methoxyphenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-methoxyphenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171219977 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1S)-1-(2-methoxyphenyl)butane-1,4-diamine;hydrochloride |
| SMILES | COc1ccccc1[C@@H](N)CCCN.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-14-11-7-3-2-5-9(11)10(13)6-4-8-12;/h2-3,5,7,10H,4,6,8,12-13H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | PFGHOIWERHPQID-PPHPATTJSA-N |
| XLogP | 1.86 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |