C11H17FN2O — CID 171221260
(1S)-1-(3-fluoro-2-methoxyphenyl)butane-1,4-diamine (PubChem CID 171221260) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is (1S)-1-(3-fluoro-2-methoxyphenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(3-fluoro-2-methoxyphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171221260 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (1S)-1-(3-fluoro-2-methoxyphenyl)butane-1,4-diamine |
| SMILES | COc1c(F)cccc1[C@@H](N)CCCN |
| InChI | InChI=1S/C11H17FN2O/c1-15-11-8(4-2-5-9(11)12)10(14)6-3-7-13/h2,4-5,10H,3,6-7,13-14H2,1H3/t10-/m0/s1 |
| InChIKey | OPWKSSPSEQVQSP-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |