C13H21ClFNO2 — CID 171267207
(1S,2R)-1-amino-1-(3-fluoro-2-methoxyphenyl)hexan-2-ol;hydrochloride (PubChem CID 171267207) has the molecular formula C13H21ClFNO2 and a molecular weight of 277.77 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-fluoro-2-methoxyphenyl)hexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(3-fluoro-2-methoxyphenyl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171267207 |
| Molecular Formula | C13H21ClFNO2 |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-fluoro-2-methoxyphenyl)hexan-2-ol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1cccc(F)c1OC.Cl |
| InChI | InChI=1S/C13H20FNO2.ClH/c1-3-4-8-11(16)12(15)9-6-5-7-10(14)13(9)17-2;/h5-7,11-12,16H,3-4,8,15H2,1-2H3;1H/t11-,12+;/m1./s1 |
| InChIKey | GNSGUCLHUTXSAD-LYCTWNKOSA-N |
| XLogP | 2.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |