C22H24ClNO — CID 171266345
(1R,2S)-1-amino-1-pyren-1-ylhexan-2-ol;hydrochloride (PubChem CID 171266345) has the molecular formula C22H24ClNO and a molecular weight of 353.89 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-pyren-1-ylhexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-pyren-1-ylhexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171266345 |
| Molecular Formula | C22H24ClNO |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (1R,2S)-1-amino-1-pyren-1-ylhexan-2-ol;hydrochloride |
| SMILES | CCCC[C@H](O)[C@H](N)c1ccc2ccc3cccc4ccc1c2c34.Cl |
| InChI | InChI=1S/C22H23NO.ClH/c1-2-3-7-19(24)22(23)18-13-11-16-9-8-14-5-4-6-15-10-12-17(18)21(16)20(14)15;/h4-6,8-13,19,22,24H,2-3,7,23H2,1H3;1H/t19-,22+;/m0./s1 |
| InChIKey | NDPZNZFGLAEVLH-MGBOEYOKSA-N |
| XLogP | 5.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|