C19H14F3NO — CID 171266338
(2R,3R)-3-amino-1,1,1-trifluoro-3-pyren-1-ylpropan-2-ol (PubChem CID 171266338) has the molecular formula C19H14F3NO and a molecular weight of 329.32 g/mol. Its IUPAC name is (2R,3R)-3-amino-1,1,1-trifluoro-3-pyren-1-ylpropan-2-ol.
| Compound Name | (2R,3R)-3-amino-1,1,1-trifluoro-3-pyren-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 171266338 |
| Molecular Formula | C19H14F3NO |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2R,3R)-3-amino-1,1,1-trifluoro-3-pyren-1-ylpropan-2-ol |
| SMILES | N[C@H](c1ccc2ccc3cccc4ccc1c2c34)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO/c20-19(21,22)18(24)17(23)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17-18,24H,23H2/t17-,18-/m1/s1 |
| InChIKey | WXIBNIWQFBFHGI-QZTJIDSGSA-N |
| XLogP | 4.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|