C19H13ClF5N — CID 171312055
(1S)-2,2,3,3,3-pentafluoro-1-pyren-1-ylpropan-1-amine;hydrochloride (PubChem CID 171312055) has the molecular formula C19H13ClF5N and a molecular weight of 385.76 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-pyren-1-ylpropan-1-amine;hydrochloride.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-pyren-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312055 |
| Molecular Formula | C19H13ClF5N |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-pyren-1-ylpropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc2ccc3cccc4ccc1c2c34)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H12F5N.ClH/c20-18(21,19(22,23)24)17(25)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;/h1-9,17H,25H2;1H/t17-;/m0./s1 |
| InChIKey | RQYVHADJBIRKSZ-LMOVPXPDSA-N |
| XLogP | 6.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|