C22H23NO — CID 171266336
(1R,2S)-1-amino-3,3-dimethyl-1-pyren-1-ylbutan-2-ol (PubChem CID 171266336) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R,2S)-1-amino-3,3-dimethyl-1-pyren-1-ylbutan-2-ol.
| Compound Name | (1R,2S)-1-amino-3,3-dimethyl-1-pyren-1-ylbutan-2-ol |
|---|---|
| PubChem CID | 171266336 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (1R,2S)-1-amino-3,3-dimethyl-1-pyren-1-ylbutan-2-ol |
| SMILES | CC(C)(C)[C@H](O)[C@H](N)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C22H23NO/c1-22(2,3)21(24)20(23)17-12-10-15-8-7-13-5-4-6-14-9-11-16(17)19(15)18(13)14/h4-12,20-21,24H,23H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | TWVMSKOSHDWWLD-NHCUHLMSSA-N |
| XLogP | 4.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|