C31H40 — CID 102523746
1-[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]pyrene (PubChem CID 102523746) has the molecular formula C31H40 and a molecular weight of 412.66 g/mol. Its IUPAC name is 1-[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]pyrene.
| Compound Name | 1-[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]pyrene |
|---|---|
| PubChem CID | 102523746 |
| Molecular Formula | C31H40 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 1-[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]pyrene |
| SMILES | CC(C)C(C(C)C)C(c1ccc2ccc3cccc4ccc1c2c34)C(C(C)C)C(C)C |
| InChI | InChI=1S/C31H40/c1-18(2)27(19(3)4)31(28(20(5)6)21(7)8)26-17-15-24-13-12-22-10-9-11-23-14-16-25(26)30(24)29(22)23/h9-21,27-28,31H,1-8H3 |
| InChIKey | MWXKLJPBFQTAJX-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|