About 4-butan-2-ylpyrene
4-butan-2-ylpyrene (PubChem CID 155644437) has the molecular formula C20H18
and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-butan-2-ylpyrene.
Molecular Properties
| Compound Name | 4-butan-2-ylpyrene |
| PubChem CID | 155644437 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-butan-2-ylpyrene |
| SMILES | CCC(C)c1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C20H18/c1-3-13(2)18-12-16-8-4-6-14-10-11-15-7-5-9-17(18)20(15)19(14)16/h4-13H,3H2,1-2H3 |
| InChIKey | GUJJYTFUHQQRRT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-ylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylpyrene?
The IUPAC name of 4-butan-2-ylpyrene (CID 155644437) is 4-butan-2-ylpyrene.
What is the SMILES notation for 4-butan-2-ylpyrene?
The canonical SMILES for 4-butan-2-ylpyrene is CCC(C)c1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of 4-butan-2-ylpyrene?
The InChIKey is GUJJYTFUHQQRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18/c1-3-13(2)18-12-16-8-4-6-14-10-11-15-7-5-9-17(18)20(15)19(14)16/h4-13H,3H2,1-2H3.
What are the key properties of 4-butan-2-ylpyrene?
4-butan-2-ylpyrene has a molecular weight of 258.36 g/mol, XLogP of 6.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylpyrene is sourced from PubChem (CID 155644437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).