About 4-(2-methylpropyl)pyrene
4-(2-methylpropyl)pyrene (PubChem CID 18737026) has the molecular formula C20H18
and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-(2-methylpropyl)pyrene.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)pyrene |
| PubChem CID | 18737026 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-(2-methylpropyl)pyrene |
| SMILES | CC(C)Cc1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C20H18/c1-13(2)11-17-12-16-7-3-5-14-9-10-15-6-4-8-18(17)20(15)19(14)16/h3-10,12-13H,11H2,1-2H3 |
| InChIKey | TVHGYJRTFVABLA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylpropyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)pyrene?
The IUPAC name of 4-(2-methylpropyl)pyrene (CID 18737026) is 4-(2-methylpropyl)pyrene.
What is the SMILES notation for 4-(2-methylpropyl)pyrene?
The canonical SMILES for 4-(2-methylpropyl)pyrene is CC(C)Cc1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of 4-(2-methylpropyl)pyrene?
The InChIKey is TVHGYJRTFVABLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18/c1-13(2)11-17-12-16-7-3-5-14-9-10-15-6-4-8-18(17)20(15)19(14)16/h3-10,12-13H,11H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)pyrene?
4-(2-methylpropyl)pyrene has a molecular weight of 258.36 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)pyrene is sourced from PubChem (CID 18737026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).