About 4-bromopyrene
4-bromopyrene (PubChem CID 3014036) has the molecular formula C16H9Br
and a molecular weight of 281.15 g/mol. Its IUPAC name is 4-bromopyrene.
Molecular Properties
| Compound Name | 4-bromopyrene |
| PubChem CID | 3014036 |
| Molecular Formula | C16H9Br |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-bromopyrene |
| SMILES | Brc1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C16H9Br/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H |
| InChIKey | QMHTZTOPYZKQLC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-bromopyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopyrene?
The IUPAC name of 4-bromopyrene (CID 3014036) is 4-bromopyrene.
What is the SMILES notation for 4-bromopyrene?
The canonical SMILES for 4-bromopyrene is Brc1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of 4-bromopyrene?
The InChIKey is QMHTZTOPYZKQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Br/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H.
What are the key properties of 4-bromopyrene?
4-bromopyrene has a molecular weight of 281.15 g/mol, XLogP of 5.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopyrene is sourced from PubChem (CID 3014036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).