C20H20ClNO — CID 171271987
(1S,2R)-1-amino-1-pyren-1-ylbutan-2-ol;hydrochloride (PubChem CID 171271987) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-pyren-1-ylbutan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-pyren-1-ylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171271987 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1S,2R)-1-amino-1-pyren-1-ylbutan-2-ol;hydrochloride |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc2ccc3cccc4ccc1c2c34.Cl |
| InChI | InChI=1S/C20H19NO.ClH/c1-2-17(22)20(21)16-11-9-14-7-6-12-4-3-5-13-8-10-15(16)19(14)18(12)13;/h3-11,17,20,22H,2,21H2,1H3;1H/t17-,20+;/m1./s1 |
| InChIKey | RBZHRPUYGLZYJX-XLCHORMMSA-N |
| XLogP | 4.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|