C23H25NO — CID 171272008
(1S,2R)-1-amino-5-methyl-1-pyren-1-ylhexan-2-ol (PubChem CID 171272008) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,2R)-1-amino-5-methyl-1-pyren-1-ylhexan-2-ol.
| Compound Name | (1S,2R)-1-amino-5-methyl-1-pyren-1-ylhexan-2-ol |
|---|---|
| PubChem CID | 171272008 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1S,2R)-1-amino-5-methyl-1-pyren-1-ylhexan-2-ol |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C23H25NO/c1-14(2)6-13-20(25)23(24)19-12-10-17-8-7-15-4-3-5-16-9-11-18(19)22(17)21(15)16/h3-5,7-12,14,20,23,25H,6,13,24H2,1-2H3/t20-,23+/m1/s1 |
| InChIKey | WMOSHQJBLPZZIH-OFNKIYASSA-N |
| XLogP | 5.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|