C21H25NO — CID 171260722
(1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol (PubChem CID 171260722) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171260722 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (1R,2S)-1-amino-1-anthracen-9-yl-5-methylhexan-2-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H25NO/c1-14(2)11-12-19(23)21(22)20-17-9-5-3-7-15(17)13-16-8-4-6-10-18(16)20/h3-10,13-14,19,21,23H,11-12,22H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | MAWLEWLAQOLIRY-FPOVZHCZSA-N |
| XLogP | 4.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|