C13H21NO4 — CID 171266400
2-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]benzene-1,3,5-triol (PubChem CID 171266400) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]benzene-1,3,5-triol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 171266400 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-5-methylhexyl]benzene-1,3,5-triol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C13H21NO4/c1-7(2)3-4-9(16)13(14)12-10(17)5-8(15)6-11(12)18/h5-7,9,13,15-18H,3-4,14H2,1-2H3/t9-,13-/m0/s1 |
| InChIKey | RLVKCZHKKXPSCD-ZANVPECISA-N |
| XLogP | 1.60 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|