C12H19NO4 — CID 171272056
2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol (PubChem CID 171272056) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 171272056 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]benzene-1,3,5-triol |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C12H19NO4/c1-3-6(2)12(17)11(13)10-8(15)4-7(14)5-9(10)16/h4-6,11-12,14-17H,3,13H2,1-2H3/t6?,11-,12+/m0/s1 |
| InChIKey | RHHUTDQDDAKNKM-DFCVHYNUSA-N |
| XLogP | 1.21 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|