C14H23NO2 — CID 171268127
4-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-2,6-dimethylphenol (PubChem CID 171268127) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-2,6-dimethylphenol.
| Compound Name | 4-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 171268127 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-hydroxy-3-methylpentyl]-2,6-dimethylphenol |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C14H23NO2/c1-5-8(2)14(17)12(15)11-6-9(3)13(16)10(4)7-11/h6-8,12,14,16-17H,5,15H2,1-4H3/t8?,12-,14+/m0/s1 |
| InChIKey | SXNFVIAHQXOBLB-GWLKJFNGSA-N |
| XLogP | 2.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |