C13H20ClNO — CID 171267982
(1S,2R)-1-amino-1-(3-chloro-4-methylphenyl)-3-methylpentan-2-ol (PubChem CID 171267982) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-chloro-4-methylphenyl)-3-methylpentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(3-chloro-4-methylphenyl)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 171267982 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-chloro-4-methylphenyl)-3-methylpentan-2-ol |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO/c1-4-8(2)13(16)12(15)10-6-5-9(3)11(14)7-10/h5-8,12-13,16H,4,15H2,1-3H3/t8?,12-,13+/m0/s1 |
| InChIKey | ZJMAXOQAGCLKIY-LFOGUXLASA-N |
| XLogP | 3.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |