C13H19ClOS — CID 107560040
2-butan-2-ylsulfanyl-1-(3-chloro-4-methylphenyl)ethanol (PubChem CID 107560040) has the molecular formula C13H19ClOS and a molecular weight of 258.81 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-1-(3-chloro-4-methylphenyl)ethanol.
| Compound Name | 2-butan-2-ylsulfanyl-1-(3-chloro-4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 107560040 |
| Molecular Formula | C13H19ClOS |
| Molecular Weight | 258.81 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-butan-2-ylsulfanyl-1-(3-chloro-4-methylphenyl)ethanol |
| SMILES | CCC(C)SCC(O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClOS/c1-4-10(3)16-8-13(15)11-6-5-9(2)12(14)7-11/h5-7,10,13,15H,4,8H2,1-3H3 |
| InChIKey | OVQCZPNZABGZBD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |