C9H10ClF2N — CID 103946952
1-(3-chloro-4-methylphenyl)-2,2-difluoroethanamine (PubChem CID 103946952) has the molecular formula C9H10ClF2N and a molecular weight of 205.64 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanamine.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 103946952 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2,2-difluoroethanamine |
| SMILES | Cc1ccc(C(N)C(F)F)cc1Cl |
| InChI | InChI=1S/C9H10ClF2N/c1-5-2-3-6(4-7(5)10)8(13)9(11)12/h2-4,8-9H,13H2,1H3 |
| InChIKey | JSVNSJXRJSVSOD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |