C10H12ClF2N — CID 131561553
(1R)-1-(3-chloro-4-methylphenyl)-3,3-difluoropropan-1-amine (PubChem CID 131561553) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is (1R)-1-(3-chloro-4-methylphenyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1R)-1-(3-chloro-4-methylphenyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 131561553 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (1R)-1-(3-chloro-4-methylphenyl)-3,3-difluoropropan-1-amine |
| SMILES | Cc1ccc([C@H](N)CC(F)F)cc1Cl |
| InChI | InChI=1S/C10H12ClF2N/c1-6-2-3-7(4-8(6)11)9(14)5-10(12)13/h2-4,9-10H,5,14H2,1H3/t9-/m1/s1 |
| InChIKey | HWQOZBLDKUFAMQ-SECBINFHSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |