C10H13ClFN — CID 131569860
(1R)-1-(3-chloro-4-methylphenyl)-3-fluoropropan-1-amine (PubChem CID 131569860) has the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. Its IUPAC name is (1R)-1-(3-chloro-4-methylphenyl)-3-fluoropropan-1-amine.
| Compound Name | (1R)-1-(3-chloro-4-methylphenyl)-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 131569860 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (1R)-1-(3-chloro-4-methylphenyl)-3-fluoropropan-1-amine |
| SMILES | Cc1ccc([C@H](N)CCF)cc1Cl |
| InChI | InChI=1S/C10H13ClFN/c1-7-2-3-8(6-9(7)11)10(13)4-5-12/h2-3,6,10H,4-5,13H2,1H3/t10-/m1/s1 |
| InChIKey | MTWMPJQWWWMJMY-SNVBAGLBSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |