C13H21NO2 — CID 131404150
4-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-2,6-dimethylphenol (PubChem CID 131404150) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-2,6-dimethylphenol.
| Compound Name | 4-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 131404150 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-2,6-dimethylphenol |
| SMILES | Cc1cc([C@H](N)[C@H](O)C(C)C)cc(C)c1O |
| InChI | InChI=1S/C13H21NO2/c1-7(2)12(15)11(14)10-5-8(3)13(16)9(4)6-10/h5-7,11-12,15-16H,14H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | WBLWEZMZGFCGFY-NWDGAFQWSA-N |
| XLogP | 2.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |