C11H15Br2NO — CID 171270900
(1S,2R)-1-amino-1-(3,5-dibromophenyl)-3-methylbutan-2-ol (PubChem CID 171270900) has the molecular formula C11H15Br2NO and a molecular weight of 337.06 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3,5-dibromophenyl)-3-methylbutan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(3,5-dibromophenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 171270900 |
| Molecular Formula | C11H15Br2NO |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | (1S,2R)-1-amino-1-(3,5-dibromophenyl)-3-methylbutan-2-ol |
| SMILES | CC(C)[C@@H](O)[C@@H](N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H15Br2NO/c1-6(2)11(15)10(14)7-3-8(12)5-9(13)4-7/h3-6,10-11,15H,14H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | UDLDZCFHACJJBH-WDEREUQCSA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |