C8H9Br2N — CID 23147757
1-(3,5-dibromophenyl)ethanamine (PubChem CID 23147757) has the molecular formula C8H9Br2N and a molecular weight of 278.98 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)ethanamine.
| Compound Name | 1-(3,5-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 23147757 |
| Molecular Formula | C8H9Br2N |
| Molecular Weight | 278.98 g/mol |
| Exact Mass | 276.91 |
| IUPAC Name | 1-(3,5-dibromophenyl)ethanamine |
| SMILES | CC(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H9Br2N/c1-5(11)6-2-7(9)4-8(10)3-6/h2-5H,11H2,1H3 |
| InChIKey | DWZJEVRHNGHMTL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |