C8H10Br2ClN — CID 171233549
(1S)-1-(3,5-dibromophenyl)ethanamine;hydrochloride (PubChem CID 171233549) has the molecular formula C8H10Br2ClN and a molecular weight of 315.44 g/mol. Its IUPAC name is (1S)-1-(3,5-dibromophenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-1-(3,5-dibromophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171233549 |
| Molecular Formula | C8H10Br2ClN |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 312.89 |
| IUPAC Name | (1S)-1-(3,5-dibromophenyl)ethanamine;hydrochloride |
| SMILES | C[C@H](N)c1cc(Br)cc(Br)c1.Cl |
| InChI | InChI=1S/C8H9Br2N.ClH/c1-5(11)6-2-7(9)4-8(10)3-6;/h2-5H,11H2,1H3;1H/t5-;/m0./s1 |
| InChIKey | FNEUDKJSLPEXNS-JEDNCBNOSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |