C7H8Br2N2 — CID 141415673
(3,5-dibromophenyl)methanediamine (PubChem CID 141415673) has the molecular formula C7H8Br2N2 and a molecular weight of 279.96 g/mol. Its IUPAC name is (3,5-dibromophenyl)methanediamine.
| Compound Name | (3,5-dibromophenyl)methanediamine |
|---|---|
| PubChem CID | 141415673 |
| Molecular Formula | C7H8Br2N2 |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | (3,5-dibromophenyl)methanediamine |
| SMILES | NC(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H8Br2N2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,7H,10-11H2 |
| InChIKey | CCUFGIVIFRTBDE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|