C8H8Br3N — CID 130135537
1-(3,4,5-tribromophenyl)ethanamine (PubChem CID 130135537) has the molecular formula C8H8Br3N and a molecular weight of 357.87 g/mol. Its IUPAC name is 1-(3,4,5-tribromophenyl)ethanamine.
| Compound Name | 1-(3,4,5-tribromophenyl)ethanamine |
|---|---|
| PubChem CID | 130135537 |
| Molecular Formula | C8H8Br3N |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 354.82 |
| IUPAC Name | 1-(3,4,5-tribromophenyl)ethanamine |
| SMILES | CC(N)c1cc(Br)c(Br)c(Br)c1 |
| InChI | InChI=1S/C8H8Br3N/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-4H,12H2,1H3 |
| InChIKey | CQRUSGNKTHCTQV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|